C6H16N4Si — CID 91038364
4,9-dimethyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane (PubChem CID 91038364) has the molecular formula C6H16N4Si and a molecular weight of 172.31 g/mol. Its IUPAC name is 4,9-dimethyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane.
| Compound Name | 4,9-dimethyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane |
|---|---|
| PubChem CID | 91038364 |
| Molecular Formula | C6H16N4Si |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 4,9-dimethyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane |
| SMILES | CN1CCN[Si]12NCCN2C |
| InChI | InChI=1S/C6H16N4Si/c1-9-5-3-7-11(9)8-4-6-10(11)2/h7-8H,3-6H2,1-2H3 |
| InChIKey | ALAQLMWKEUCUOK-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|