C43H34N10O3 — CID 91040838
1,2-bis[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-(6-methoxy-3-pyridinyl)-2-(4-pyridin-3-ylphenyl)hydrazine (PubChem CID 91040838) has the molecular formula C43H34N10O3 and a molecular weight of 738.81 g/mol. Its IUPAC name is 1,2-bis[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-(6-methoxy-3-pyridinyl)-2-(4-pyridin-3-ylphenyl)hydrazine.
| Compound Name | 1,2-bis[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-(6-methoxy-3-pyridinyl)-2-(4-pyridin-3-ylphenyl)hydrazine |
|---|---|
| PubChem CID | 91040838 |
| Molecular Formula | C43H34N10O3 |
| Molecular Weight | 738.81 g/mol |
| Exact Mass | 738.28 |
| IUPAC Name | 1,2-bis[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-(6-methoxy-3-pyridinyl)-2-(4-pyridin-3-ylphenyl)hydrazine |
| SMILES | COc1ccc(-c2cccc3nc(N(c4ccc(-c5cccnc5)cc4)N(c4ccc(OC)nc4)c4nc5cccc(-c6ccc(OC)cc6)n5n4)nn23)cc1 |
| InChI | InChI=1S/C43H34N10O3/c1-54-35-21-14-30(15-22-35)37-8-4-10-39-46-42(48-50(37)39)52(33-18-12-29(13-19-33)32-7-6-26-44-27-32)53(34-20-25-41(56-3)45-28-34)43-47-40-11-5-9-38(51(40)49-43)31-16-23-36(55-2)24-17-31/h4-28H,1-3H3 |
| InChIKey | USKOWGCUUFWJFZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 120.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|