C23H32ClN3O2 — CID 91041032
6-chloro-N-(cyclohexylmethyl)-2-[3-(3-hydroxypropylamino)propyl]quinoline-3-carboxamide (PubChem CID 91041032) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 6-chloro-N-(cyclohexylmethyl)-2-[3-(3-hydroxypropylamino)propyl]quinoline-3-carboxamide.
| Compound Name | 6-chloro-N-(cyclohexylmethyl)-2-[3-(3-hydroxypropylamino)propyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 91041032 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 6-chloro-N-(cyclohexylmethyl)-2-[3-(3-hydroxypropylamino)propyl]quinoline-3-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1cc2cc(Cl)ccc2nc1CCCNCCCO |
| InChI | InChI=1S/C23H32ClN3O2/c24-19-9-10-21-18(14-19)15-20(22(27-21)8-4-11-25-12-5-13-28)23(29)26-16-17-6-2-1-3-7-17/h9-10,14-15,17,25,28H,1-8,11-13,16H2,(H,26,29) |
| InChIKey | VDDQFIYQJGXEJP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|