C23H18FNO4S — CID 91041563
2-fluoro-4-(4-methoxyphenyl)-3-(4-methoxyphenyl)sulfonylquinoline (PubChem CID 91041563) has the molecular formula C23H18FNO4S and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-fluoro-4-(4-methoxyphenyl)-3-(4-methoxyphenyl)sulfonylquinoline.
| Compound Name | 2-fluoro-4-(4-methoxyphenyl)-3-(4-methoxyphenyl)sulfonylquinoline |
|---|---|
| PubChem CID | 91041563 |
| Molecular Formula | C23H18FNO4S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-fluoro-4-(4-methoxyphenyl)-3-(4-methoxyphenyl)sulfonylquinoline |
| SMILES | COc1ccc(-c2c(S(=O)(=O)c3ccc(OC)cc3)c(F)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H18FNO4S/c1-28-16-9-7-15(8-10-16)21-19-5-3-4-6-20(19)25-23(24)22(21)30(26,27)18-13-11-17(29-2)12-14-18/h3-14H,1-2H3 |
| InChIKey | VLEMTGPCEMZQFE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|