C21H32O2 — CID 91041768
1-(2,3,4,4a,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-3-methylidenenonane-1,2-dione (PubChem CID 91041768) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-(2,3,4,4a,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-3-methylidenenonane-1,2-dione.
| Compound Name | 1-(2,3,4,4a,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-3-methylidenenonane-1,2-dione |
|---|---|
| PubChem CID | 91041768 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 1-(2,3,4,4a,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-3-methylidenenonane-1,2-dione |
| SMILES | C=C(CCCCCC)C(=O)C(=O)C1=CC2CCCCC2CCC1 |
| InChI | InChI=1S/C21H32O2/c1-3-4-5-6-10-16(2)20(22)21(23)19-14-9-13-17-11-7-8-12-18(17)15-19/h15,17-18H,2-14H2,1H3 |
| InChIKey | KVBKOLNAMCHFSI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|