C19H25FN4O3 — CID 91042796
methyl 2-[4-(4-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 91042796) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl 2-[4-(4-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | methyl 2-[4-(4-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91042796 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | methyl 2-[4-(4-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCCC1N1CCC(n2c(=O)[nH]c3c(F)cccc32)CC1 |
| InChI | InChI=1S/C19H25FN4O3/c1-27-19(26)23-10-3-2-7-16(23)22-11-8-13(9-12-22)24-15-6-4-5-14(20)17(15)21-18(24)25/h4-6,13,16H,2-3,7-12H2,1H3,(H,21,25) |
| InChIKey | CFVMIYRAGARXHT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |