C15H15F3N2O — CID 91042851
9-prop-2-enyl-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol (PubChem CID 91042851) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is 9-prop-2-enyl-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol.
| Compound Name | 9-prop-2-enyl-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
|---|---|
| PubChem CID | 91042851 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 9-prop-2-enyl-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
| SMILES | C=CCc1cc(C(F)(F)F)c2c(O)n3c(c2c1)CNCC3 |
| InChI | InChI=1S/C15H15F3N2O/c1-2-3-9-6-10-12-8-19-4-5-20(12)14(21)13(10)11(7-9)15(16,17)18/h2,6-7,19,21H,1,3-5,8H2 |
| InChIKey | BWGDIGIANJAAOC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|