C21H25NO — CID 91043678
2-cyclopentyl-N-[(3-methylphenyl)methyl]-N-phenylacetamide (PubChem CID 91043678) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(3-methylphenyl)methyl]-N-phenylacetamide.
| Compound Name | 2-cyclopentyl-N-[(3-methylphenyl)methyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 91043678 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-cyclopentyl-N-[(3-methylphenyl)methyl]-N-phenylacetamide |
| SMILES | Cc1cccc(CN(C(=O)CC2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H25NO/c1-17-8-7-11-19(14-17)16-22(20-12-3-2-4-13-20)21(23)15-18-9-5-6-10-18/h2-4,7-8,11-14,18H,5-6,9-10,15-16H2,1H3 |
| InChIKey | QRPNPNWRYLEXLJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |