C26H27NO2S — CID 70974316
N-(2-acetyl-5-phenylthiophen-3-yl)-N-benzyl-2-cyclopentylacetamide (PubChem CID 70974316) has the molecular formula C26H27NO2S and a molecular weight of 417.57 g/mol. Its IUPAC name is N-(2-acetyl-5-phenylthiophen-3-yl)-N-benzyl-2-cyclopentylacetamide.
| Compound Name | N-(2-acetyl-5-phenylthiophen-3-yl)-N-benzyl-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 70974316 |
| Molecular Formula | C26H27NO2S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(2-acetyl-5-phenylthiophen-3-yl)-N-benzyl-2-cyclopentylacetamide |
| SMILES | CC(=O)c1sc(-c2ccccc2)cc1N(Cc1ccccc1)C(=O)CC1CCCC1 |
| InChI | InChI=1S/C26H27NO2S/c1-19(28)26-23(17-24(30-26)22-14-6-3-7-15-22)27(18-21-12-4-2-5-13-21)25(29)16-20-10-8-9-11-20/h2-7,12-15,17,20H,8-11,16,18H2,1H3 |
| InChIKey | GSYGJRHPAWXFSP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |