C18H23N3O6 — CID 91046557
hydroxycarbamoyl [6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] carbonate (PubChem CID 91046557) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is hydroxycarbamoyl [6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] carbonate.
| Compound Name | hydroxycarbamoyl [6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] carbonate |
|---|---|
| PubChem CID | 91046557 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | hydroxycarbamoyl [6-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidin-3-yl] carbonate |
| SMILES | O=C(NO)OC(=O)OC1CCC(C(=O)N2CC[C@H](c3ccccc3)C2)NC1 |
| InChI | InChI=1S/C18H23N3O6/c22-16(21-9-8-13(11-21)12-4-2-1-3-5-12)15-7-6-14(10-19-15)26-18(24)27-17(23)20-25/h1-5,13-15,19,25H,6-11H2,(H,20,23)/t13-,14?,15?/m0/s1 |
| InChIKey | LLKHNNIPZBQNGV-NFOMZHRRSA-N |
| XLogP | 1.38 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|