C23H26N2O3S — CID 91047086
3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]-N-(2-sulfanylethyl)benzamide (PubChem CID 91047086) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]-N-(2-sulfanylethyl)benzamide.
| Compound Name | 3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]-N-(2-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 91047086 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]-N-(2-sulfanylethyl)benzamide |
| SMILES | COc1ccc2c(c1)C(CC(=O)c1cccc(C(=O)NCCS)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C23H26N2O3S/c1-23(2)14-17-7-8-18(28-3)12-19(17)20(25-23)13-21(26)15-5-4-6-16(11-15)22(27)24-9-10-29/h4-8,11-12,29H,9-10,13-14H2,1-3H3,(H,24,27) |
| InChIKey | OZEWAFRIQPVDKC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|