C24H39N3O4 — CID 91050021
4-[1-(methoxyamino)ethenyl]-2-[[1-[4-(2-methoxyethoxy)-1-methylcyclohexyl]piperidin-4-yl]amino]phenol (PubChem CID 91050021) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 4-[1-(methoxyamino)ethenyl]-2-[[1-[4-(2-methoxyethoxy)-1-methylcyclohexyl]piperidin-4-yl]amino]phenol.
| Compound Name | 4-[1-(methoxyamino)ethenyl]-2-[[1-[4-(2-methoxyethoxy)-1-methylcyclohexyl]piperidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 91050021 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 4-[1-(methoxyamino)ethenyl]-2-[[1-[4-(2-methoxyethoxy)-1-methylcyclohexyl]piperidin-4-yl]amino]phenol |
| SMILES | C=C(NOC)c1ccc(O)c(NC2CCN(C3(C)CCC(OCCOC)CC3)CC2)c1 |
| InChI | InChI=1S/C24H39N3O4/c1-18(26-30-4)19-5-6-23(28)22(17-19)25-20-9-13-27(14-10-20)24(2)11-7-21(8-12-24)31-16-15-29-3/h5-6,17,20-21,25-26,28H,1,7-16H2,2-4H3 |
| InChIKey | LYWVIWQYNNZKNR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|