C9H12Cl2N4O — CID 91050598
1-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]-2-methylpropan-2-ol (PubChem CID 91050598) has the molecular formula C9H12Cl2N4O and a molecular weight of 263.13 g/mol. Its IUPAC name is 1-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 91050598 |
| Molecular Formula | C9H12Cl2N4O |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]-2-methylpropan-2-ol |
| SMILES | [H]/N=C/c1c(Cl)nc(Cl)nc1NCC(C)(C)O |
| InChI | InChI=1S/C9H12Cl2N4O/c1-9(2,16)4-13-7-5(3-12)6(10)14-8(11)15-7/h3,12,16H,4H2,1-2H3,(H,13,14,15)/b12-3+ |
| InChIKey | XUFHZOLKFRKXAC-KGVSQERTSA-N |
| XLogP | 1.96 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|