C34H35FN2O2 — CID 91050881
3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one (PubChem CID 91050881) has the molecular formula C34H35FN2O2 and a molecular weight of 522.66 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 91050881 |
| Molecular Formula | C34H35FN2O2 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]-5-phenylpenta-2,4-dien-1-one |
| SMILES | CC(C)(C)c1ccc(C(C=Cc2ccccc2)=CC(=O)N2CCC3(C=C(c4cccc(F)c4)NO3)CC2)cc1 |
| InChI | InChI=1S/C34H35FN2O2/c1-33(2,3)29-16-14-26(15-17-29)27(13-12-25-8-5-4-6-9-25)23-32(38)37-20-18-34(19-21-37)24-31(36-39-34)28-10-7-11-30(35)22-28/h4-17,22-24,36H,18-21H2,1-3H3 |
| InChIKey | UMBHHMJWYJEFDA-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|