C26H29FN2O2 — CID 91223295
3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one (PubChem CID 91223295) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91223295 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[3-(3-fluorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(C=CC(=O)N2CCC3(C=C(c4cccc(F)c4)NO3)CC2)cc1 |
| InChI | InChI=1S/C26H29FN2O2/c1-25(2,3)21-10-7-19(8-11-21)9-12-24(30)29-15-13-26(14-16-29)18-23(28-31-26)20-5-4-6-22(27)17-20/h4-12,17-18,28H,13-16H2,1-3H3 |
| InChIKey | YGWYSPQMJSHMJH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|