C26H30N2O2 — CID 90790867
1-(4-tert-butylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one (PubChem CID 90790867) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90790867 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)C=CN2CCC3(C=C(c4ccccc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-25(2,3)22-11-9-21(10-12-22)24(29)13-16-28-17-14-26(15-18-28)19-23(27-30-26)20-7-5-4-6-8-20/h4-13,16,19,27H,14-15,17-18H2,1-3H3 |
| InChIKey | BMEVJTQYYYYTIC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|