C30H38N2O2 — CID 90745080
1-(4-tert-butylphenyl)-3-[3-(4-tert-butylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one (PubChem CID 90745080) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-(4-tert-butylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-(4-tert-butylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90745080 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-(4-tert-butylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)C=CN2CCC3(C=C(c4ccc(C(C)(C)C)cc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C30H38N2O2/c1-28(2,3)24-11-7-22(8-12-24)26-21-30(34-31-26)16-19-32(20-17-30)18-15-27(33)23-9-13-25(14-10-23)29(4,5)6/h7-15,18,21,31H,16-17,19-20H2,1-6H3 |
| InChIKey | RPURLPCPIUSZKA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|