C26H46O5Si — CID 91051646
13-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacyclodocosa-9,17-diene-8,19-dione (PubChem CID 91051646) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is 13-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacyclodocosa-9,17-diene-8,19-dione.
| Compound Name | 13-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacyclodocosa-9,17-diene-8,19-dione |
|---|---|
| PubChem CID | 91051646 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 13-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxacyclodocosa-9,17-diene-8,19-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC=CC(=O)CCCOCCOCCCC(=O)C=CCCC1 |
| InChI | InChI=1S/C26H46O5Si/c1-26(2,3)32(4,5)31-25-17-8-6-7-13-23(27)15-11-19-29-21-22-30-20-12-16-24(28)14-9-10-18-25/h7,9,13-14,25H,6,8,10-12,15-22H2,1-5H3 |
| InChIKey | LFSLEHMHCVXAAA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|