C32H31N3O4 — CID 91052366
1-[4-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]-3-(4-phenoxyphenyl)imidazol-2-one (PubChem CID 91052366) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is 1-[4-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]-3-(4-phenoxyphenyl)imidazol-2-one.
| Compound Name | 1-[4-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]-3-(4-phenoxyphenyl)imidazol-2-one |
|---|---|
| PubChem CID | 91052366 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 1-[4-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]-3-(4-phenoxyphenyl)imidazol-2-one |
| SMILES | COc1cccc(C(C)NCCOc2ccc(-n3ccn(-c4ccc(Oc5ccccc5)cc4)c3=O)cc2)c1 |
| InChI | InChI=1S/C32H31N3O4/c1-24(25-7-6-10-31(23-25)37-2)33-19-22-38-28-15-11-26(12-16-28)34-20-21-35(32(34)36)27-13-17-30(18-14-27)39-29-8-4-3-5-9-29/h3-18,20-21,23-24,33H,19,22H2,1-2H3 |
| InChIKey | CUXXSWWLDDNWKI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|