C23H25N3O5 — CID 51369909
2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-[1-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 51369909) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-[1-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-[1-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 51369909 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-[1-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(-n2ccn(CC(=O)NC(C)c3cccc(OC)c3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-4-31-19-10-8-18(9-11-19)26-13-12-25(22(28)23(26)29)15-21(27)24-16(2)17-6-5-7-20(14-17)30-3/h5-14,16H,4,15H2,1-3H3,(H,24,27) |
| InChIKey | CCXMHMYYGKAVHJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|