C23H25N3O7 — CID 50928754
2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 50928754) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50928754 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(-n2ccn(CC(=O)Nc3cc(OC)c(OC)c(OC)c3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C23H25N3O7/c1-5-33-17-8-6-16(7-9-17)26-11-10-25(22(28)23(26)29)14-20(27)24-15-12-18(30-2)21(32-4)19(13-15)31-3/h6-13H,5,14H2,1-4H3,(H,24,27) |
| InChIKey | VBAROXAIALXMID-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|