C21H20ClN3O4 — CID 50928759
N-(2-chloro-6-methylphenyl)-2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide (PubChem CID 50928759) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 50928759 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
| SMILES | CCOc1ccc(-n2ccn(CC(=O)Nc3c(C)cccc3Cl)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C21H20ClN3O4/c1-3-29-16-9-7-15(8-10-16)25-12-11-24(20(27)21(25)28)13-18(26)23-19-14(2)5-4-6-17(19)22/h4-12H,3,13H2,1-2H3,(H,23,26) |
| InChIKey | IFDRMTJPQDQIBE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|