C22H23N3O4 — CID 51369913
2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(1-phenylethyl)acetamide (PubChem CID 51369913) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 51369913 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(1-phenylethyl)acetamide |
| SMILES | CCOc1ccc(-n2ccn(CC(=O)NC(C)c3ccccc3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-29-19-11-9-18(10-12-19)25-14-13-24(21(27)22(25)28)15-20(26)23-16(2)17-7-5-4-6-8-17/h4-14,16H,3,15H2,1-2H3,(H,23,26) |
| InChIKey | VPZQGZIROVMKTO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|