C28H26ClN3O4 — CID 4614673
2-[4-[[4-chloro-1-(4-ethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-(1-phenylethyl)acetamide (PubChem CID 4614673) has the molecular formula C28H26ClN3O4 and a molecular weight of 503.99 g/mol. Its IUPAC name is 2-[4-[[4-chloro-1-(4-ethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-[[4-chloro-1-(4-ethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4614673 |
| Molecular Formula | C28H26ClN3O4 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-[4-[[4-chloro-1-(4-ethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-(1-phenylethyl)acetamide |
| SMILES | CCOc1ccc(N2C(=O)C(Cl)=C(Nc3ccc(CC(=O)NC(C)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H26ClN3O4/c1-3-36-23-15-13-22(14-16-23)32-27(34)25(29)26(28(32)35)31-21-11-9-19(10-12-21)17-24(33)30-18(2)20-7-5-4-6-8-20/h4-16,18,31H,3,17H2,1-2H3,(H,30,33) |
| InChIKey | WZDFTCLSVJVNMR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|