C21H21N3O5 — CID 30564683
2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 30564683) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30564683 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc(-n2ccn(CC(=O)Nc3cccc(OC)c3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-3-29-17-9-7-16(8-10-17)24-12-11-23(20(26)21(24)27)14-19(25)22-15-5-4-6-18(13-15)28-2/h4-13H,3,14H2,1-2H3,(H,22,25) |
| InChIKey | SRBJDDJLPPHBOT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|