C25H21ClF3N3O2 — CID 91052379
N-[1-(3-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-2,2-difluoropropanamide (PubChem CID 91052379) has the molecular formula C25H21ClF3N3O2 and a molecular weight of 487.91 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-2,2-difluoropropanamide.
| Compound Name | N-[1-(3-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 91052379 |
| Molecular Formula | C25H21ClF3N3O2 |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[1-(3-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-2,2-difluoropropanamide |
| SMILES | CCC(NC(=O)C(C)(F)F)(Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H21ClF3N3O2/c1-3-25(31-23(33)24(2,28)29,17-5-4-6-18(26)14-17)34-21-11-12-22-16(13-21)15-30-32(22)20-9-7-19(27)8-10-20/h4-15H,3H2,1-2H3,(H,31,33) |
| InChIKey | ZMRPRFQPTSTIEY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|