C27H25ClFN3O2 — CID 91336802
N-[1-(4-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 91336802) has the molecular formula C27H25ClFN3O2 and a molecular weight of 477.97 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91336802 |
| Molecular Formula | C27H25ClFN3O2 |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-[1-(4-chlorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CCC(NC(=O)C1(C)CC1)(Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H25ClFN3O2/c1-3-27(19-4-6-20(28)7-5-19,31-25(33)26(2)14-15-26)34-23-12-13-24-18(16-23)17-30-32(24)22-10-8-21(29)9-11-22/h4-13,16-17H,3,14-15H2,1-2H3,(H,31,33) |
| InChIKey | WLSCTOOYVYMKHK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|