C19H18ClN3O3 — CID 91052837
7-chloro-6-(2,6-dimethylmorpholin-4-yl)-3-pyridin-2-yl-1,2-benzoxazole-5-carbaldehyde (PubChem CID 91052837) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 7-chloro-6-(2,6-dimethylmorpholin-4-yl)-3-pyridin-2-yl-1,2-benzoxazole-5-carbaldehyde.
| Compound Name | 7-chloro-6-(2,6-dimethylmorpholin-4-yl)-3-pyridin-2-yl-1,2-benzoxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 91052837 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 7-chloro-6-(2,6-dimethylmorpholin-4-yl)-3-pyridin-2-yl-1,2-benzoxazole-5-carbaldehyde |
| SMILES | CC1CN(c2c(C=O)cc3c(-c4ccccn4)noc3c2Cl)CC(C)O1 |
| InChI | InChI=1S/C19H18ClN3O3/c1-11-8-23(9-12(2)25-11)18-13(10-24)7-14-17(15-5-3-4-6-21-15)22-26-19(14)16(18)20/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | RXZOIRGAMSYOMJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|