C55H54B2Br2N2O4 — CID 91053059
9-[3-carbazol-9-yl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole;1,4-dibromobenzene;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane (PubChem CID 91053059) has the molecular formula C55H54B2Br2N2O4 and a molecular weight of 988.48 g/mol. Its IUPAC name is 9-[3-carbazol-9-yl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole;1,4-dibromobenzene;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane.
| Compound Name | 9-[3-carbazol-9-yl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole;1,4-dibromobenzene;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 91053059 |
| Molecular Formula | C55H54B2Br2N2O4 |
| Molecular Weight | 988.48 g/mol |
| Exact Mass | 986.26 |
| IUPAC Name | 9-[3-carbazol-9-yl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole;1,4-dibromobenzene;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
| SMILES | Brc1ccc(Br)cc1.CB1OC(C)(C)C(C)(C)O1.CC1(C)OB(c2ccc(-c3cc(-n4c5ccccc5c5ccccc54)cc(-n4c5ccccc5c5ccccc54)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C42H35BN2O2.C7H15BO2.C6H4Br2/c1-41(2)42(3,4)47-43(46-41)30-23-21-28(22-24-30)29-25-31(44-37-17-9-5-13-33(37)34-14-6-10-18-38(34)44)27-32(26-29)45-39-19-11-7-15-35(39)36-16-8-12-20-40(36)45;1-6(2)7(3,4)10-8(5)9-6;7-5-1-2-6(8)4-3-5/h5-27H,1-4H3;1-5H3;1-4H |
| InChIKey | XULUPDCZHXGJQG-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.48 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|