C15H15NO2S — CID 91054956
3-(cyclodecapentaenylmethylsulfanyl)-1H-pyrrole-2,5-diol (PubChem CID 91054956) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-(cyclodecapentaenylmethylsulfanyl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(cyclodecapentaenylmethylsulfanyl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91054956 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(cyclodecapentaenylmethylsulfanyl)-1H-pyrrole-2,5-diol |
| SMILES | Oc1cc(SCc2ccccccccc2)c(O)[nH]1 |
| InChI | InChI=1S/C15H15NO2S/c17-14-10-13(15(18)16-14)19-11-12-8-6-4-2-1-3-5-7-9-12/h1-10,16-18H,11H2/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,9-7-,12-8+,12-9+ |
| InChIKey | LAMHUNWZNBPJDC-JOURZZCFSA-N |
| XLogP | 3.84 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |