C31H48N2O4 — CID 91055580
(2S,4aS,6aR,6aS,6bR,12aS,14bR)-N-hydroxy-10-(methoxyamino)-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-2-carboxamide (PubChem CID 91055580) has the molecular formula C31H48N2O4 and a molecular weight of 512.74 g/mol. Its IUPAC name is (2S,4aS,6aR,6aS,6bR,12aS,14bR)-N-hydroxy-10-(methoxyamino)-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-2-carboxamide.
| Compound Name | (2S,4aS,6aR,6aS,6bR,12aS,14bR)-N-hydroxy-10-(methoxyamino)-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 91055580 |
| Molecular Formula | C31H48N2O4 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.36 |
| IUPAC Name | (2S,4aS,6aR,6aS,6bR,12aS,14bR)-N-hydroxy-10-(methoxyamino)-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-2-carboxamide |
| SMILES | CONC1=CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2C(=O)C=C2[C@@H]4C[C@@](C)(C(=O)NO)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C31H48N2O4/c1-26(2)22-9-12-31(7)24(29(22,5)11-10-23(26)33-37-8)21(34)17-19-20-18-28(4,25(35)32-36)14-13-27(20,3)15-16-30(19,31)6/h10,17,20,22,24,33,36H,9,11-16,18H2,1-8H3,(H,32,35)/t20-,22?,24+,27+,28-,29-,30+,31+/m0/s1 |
| InChIKey | JFHZULQKHYMMPT-ODBJWYBOSA-N |
| XLogP | 6.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|