C33H52N2O4 — CID 90736915
(2S,4aS,6aR,6aS,6bR,12aS,14bR)-10-[methoxy-(methoxyamino)methylidene]-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide (PubChem CID 90736915) has the molecular formula C33H52N2O4 and a molecular weight of 540.79 g/mol. Its IUPAC name is (2S,4aS,6aR,6aS,6bR,12aS,14bR)-10-[methoxy-(methoxyamino)methylidene]-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide.
| Compound Name | (2S,4aS,6aR,6aS,6bR,12aS,14bR)-10-[methoxy-(methoxyamino)methylidene]-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 90736915 |
| Molecular Formula | C33H52N2O4 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | (2S,4aS,6aR,6aS,6bR,12aS,14bR)-10-[methoxy-(methoxyamino)methylidene]-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide |
| SMILES | CONC(OC)=C1CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2C(=O)C=C2[C@@H]4C[C@@](C)(C(N)=O)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C33H52N2O4/c1-28(2)20(26(38-8)35-39-9)10-12-31(5)24(28)11-13-33(7)25(31)23(36)18-21-22-19-30(4,27(34)37)15-14-29(22,3)16-17-32(21,33)6/h18,22,24-25,35H,10-17,19H2,1-9H3,(H2,34,37)/t22-,24?,25+,29+,30-,31-,32+,33+/m0/s1 |
| InChIKey | LMLVCWSGADCBIS-ONFVFKBHSA-N |
| XLogP | 6.46 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|