C36H51NO4 — CID 91186081
(2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-10-phenoxy-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide (PubChem CID 91186081) has the molecular formula C36H51NO4 and a molecular weight of 561.81 g/mol. Its IUPAC name is (2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-10-phenoxy-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide.
| Compound Name | (2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-10-phenoxy-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 91186081 |
| Molecular Formula | C36H51NO4 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | (2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-10-phenoxy-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide |
| SMILES | CC1(C)C2CC[C@]3(C)[C@H](C(=O)C=C4[C@@H]5C[C@@](C)(C(N)=O)CC[C@]5(C)CC[C@]43C)[C@@]2(C)CC[C@]1(O)Oc1ccccc1 |
| InChI | InChI=1S/C36H51NO4/c1-30(2)27-13-14-35(7)28(33(27,5)18-20-36(30,40)41-23-11-9-8-10-12-23)26(38)21-24-25-22-32(4,29(37)39)16-15-31(25,3)17-19-34(24,35)6/h8-12,21,25,27-28,40H,13-20,22H2,1-7H3,(H2,37,39)/t25-,27?,28+,31+,32-,33-,34+,35+,36-/m0/s1 |
| InChIKey | XQJWPRWTTSLWBU-GCVYBTBLSA-N |
| XLogP | 7.22 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|