C11H9F3N4O2 — CID 91056095
3-[3-(azidomethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol (PubChem CID 91056095) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 3-[3-(azidomethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol.
| Compound Name | 3-[3-(azidomethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 91056095 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-[3-(azidomethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
| SMILES | [N-]=[N+]=NCc1cccc(C2=CC(O)(C(F)(F)F)ON2)c1 |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)10(19)5-9(17-20-10)8-3-1-2-7(4-8)6-16-18-15/h1-5,17,19H,6H2 |
| InChIKey | CNTPDHXFBKDBHI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|