C11H8F5NO2 — CID 91253890
5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-2H-1,2-oxazol-5-ol (PubChem CID 91253890) has the molecular formula C11H8F5NO2 and a molecular weight of 281.18 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-2H-1,2-oxazol-5-ol.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-2H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 91253890 |
| Molecular Formula | C11H8F5NO2 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-2H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)C(F)(F)F)C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C11H8F5NO2/c12-10(13,11(14,15)16)9(18)6-8(17-19-9)7-4-2-1-3-5-7/h1-6,17-18H |
| InChIKey | WDZHVEFVWYLEEA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|