C10H9F3N2O2 — CID 90717057
3-(4-aminophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol (PubChem CID 90717057) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is 3-(4-aminophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol.
| Compound Name | 3-(4-aminophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 90717057 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-(4-aminophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
| SMILES | Nc1ccc(C2=CC(O)(C(F)(F)F)ON2)cc1 |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)9(16)5-8(15-17-9)6-1-3-7(14)4-2-6/h1-5,15-16H,14H2 |
| InChIKey | MYOROHNJAGBCIJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|