C10H15FO — CID 91057405
4-ethylidene-7-fluoroocta-5,7-dien-3-ol (PubChem CID 91057405) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is 4-ethylidene-7-fluoroocta-5,7-dien-3-ol.
| Compound Name | 4-ethylidene-7-fluoroocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 91057405 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-ethylidene-7-fluoroocta-5,7-dien-3-ol |
| SMILES | C=C(F)C=CC(=CC)C(O)CC |
| InChI | InChI=1S/C10H15FO/c1-4-9(10(12)5-2)7-6-8(3)11/h4,6-7,10,12H,3,5H2,1-2H3 |
| InChIKey | WQQNESTVZFBDFP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|