C9H16O3 — CID 24763079
(2S,3Z,5E,7R)-4-(hydroxymethyl)octa-3,5-diene-2,7-diol (PubChem CID 24763079) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2S,3Z,5E,7R)-4-(hydroxymethyl)octa-3,5-diene-2,7-diol.
| Compound Name | (2S,3Z,5E,7R)-4-(hydroxymethyl)octa-3,5-diene-2,7-diol |
|---|---|
| PubChem CID | 24763079 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2S,3Z,5E,7R)-4-(hydroxymethyl)octa-3,5-diene-2,7-diol |
| SMILES | C[C@H](O)/C=C(/C=C/[C@@H](C)O)CO |
| InChI | InChI=1S/C9H16O3/c1-7(11)3-4-9(6-10)5-8(2)12/h3-5,7-8,10-12H,6H2,1-2H3/b4-3+,9-5-/t7-,8+/m1/s1 |
| InChIKey | KWETYTFGFLMCQO-HGGYWPJWSA-N |
| XLogP | 0.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|