C19H16FNO4 — CID 91057653
4-[4-[(3-fluorophenyl)methoxy]phenoxy]-2H-pyridine-1-carboxylic acid (PubChem CID 91057653) has the molecular formula C19H16FNO4 and a molecular weight of 341.34 g/mol. Its IUPAC name is 4-[4-[(3-fluorophenyl)methoxy]phenoxy]-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[4-[(3-fluorophenyl)methoxy]phenoxy]-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 91057653 |
| Molecular Formula | C19H16FNO4 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-[4-[(3-fluorophenyl)methoxy]phenoxy]-2H-pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1C=CC(Oc2ccc(OCc3cccc(F)c3)cc2)=CC1 |
| InChI | InChI=1S/C19H16FNO4/c20-15-3-1-2-14(12-15)13-24-16-4-6-17(7-5-16)25-18-8-10-21(11-9-18)19(22)23/h1-10,12H,11,13H2,(H,22,23) |
| InChIKey | LPUGTYAHPZHJOR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |