C22H22BrF2N2O6P — CID 91057910
methyl 4-[3-[[3-bromo-4-(difluorooxyphosphorylmethyl)phenyl]methyl]-2-oxo-5-propyl-1H-imidazol-4-yl]benzoate (PubChem CID 91057910) has the molecular formula C22H22BrF2N2O6P and a molecular weight of 559.30 g/mol. Its IUPAC name is methyl 4-[3-[[3-bromo-4-(difluorooxyphosphorylmethyl)phenyl]methyl]-2-oxo-5-propyl-1H-imidazol-4-yl]benzoate.
| Compound Name | methyl 4-[3-[[3-bromo-4-(difluorooxyphosphorylmethyl)phenyl]methyl]-2-oxo-5-propyl-1H-imidazol-4-yl]benzoate |
|---|---|
| PubChem CID | 91057910 |
| Molecular Formula | C22H22BrF2N2O6P |
| Molecular Weight | 559.30 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | methyl 4-[3-[[3-bromo-4-(difluorooxyphosphorylmethyl)phenyl]methyl]-2-oxo-5-propyl-1H-imidazol-4-yl]benzoate |
| SMILES | CCCc1[nH]c(=O)n(Cc2ccc(CP(=O)(OF)OF)c(Br)c2)c1-c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C22H22BrF2N2O6P/c1-3-4-19-20(15-7-9-16(10-8-15)21(28)31-2)27(22(29)26-19)12-14-5-6-17(18(23)11-14)13-34(30,32-24)33-25/h5-11H,3-4,12-13H2,1-2H3,(H,26,29) |
| InChIKey | PWVZLTQZTVLUDC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.30 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|