C22H22O — CID 91059261
2-(5,7-dimethylocta-1,3,5-trien-2-yl)dibenzofuran (PubChem CID 91059261) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(5,7-dimethylocta-1,3,5-trien-2-yl)dibenzofuran.
| Compound Name | 2-(5,7-dimethylocta-1,3,5-trien-2-yl)dibenzofuran |
|---|---|
| PubChem CID | 91059261 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-(5,7-dimethylocta-1,3,5-trien-2-yl)dibenzofuran |
| SMILES | C=C(C=CC(C)=CC(C)C)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C22H22O/c1-15(2)13-16(3)9-10-17(4)18-11-12-22-20(14-18)19-7-5-6-8-21(19)23-22/h5-15H,4H2,1-3H3 |
| InChIKey | XLHOZWIXJMBYCA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|