C31H26O4 — CID 163980863
2-dibenzofuran-2-ylbut-2-en-1-ol;2-dibenzofuran-2-ylprop-2-en-1-ol (PubChem CID 163980863) has the molecular formula C31H26O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-dibenzofuran-2-ylbut-2-en-1-ol;2-dibenzofuran-2-ylprop-2-en-1-ol.
| Compound Name | 2-dibenzofuran-2-ylbut-2-en-1-ol;2-dibenzofuran-2-ylprop-2-en-1-ol |
|---|---|
| PubChem CID | 163980863 |
| Molecular Formula | C31H26O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-dibenzofuran-2-ylbut-2-en-1-ol;2-dibenzofuran-2-ylprop-2-en-1-ol |
| SMILES | C=C(CO)c1ccc2oc3ccccc3c2c1.CC=C(CO)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C16H14O2.C15H12O2/c1-2-11(10-17)12-7-8-16-14(9-12)13-5-3-4-6-15(13)18-16;1-10(9-16)11-6-7-15-13(8-11)12-4-2-3-5-14(12)17-15/h2-9,17H,10H2,1H3;2-8,16H,1,9H2 |
| InChIKey | SYGKQPINLHFEKV-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |