C17H14F3N3OS2 — CID 91059586
5-methyl-1-(pyridin-4-ylmethyl)-4-sulfanyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one (PubChem CID 91059586) has the molecular formula C17H14F3N3OS2 and a molecular weight of 397.45 g/mol. Its IUPAC name is 5-methyl-1-(pyridin-4-ylmethyl)-4-sulfanyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one.
| Compound Name | 5-methyl-1-(pyridin-4-ylmethyl)-4-sulfanyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 91059586 |
| Molecular Formula | C17H14F3N3OS2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 5-methyl-1-(pyridin-4-ylmethyl)-4-sulfanyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one |
| SMILES | Cc1c(S)n(-c2ccc(SC(F)(F)F)cc2)c(=O)n1Cc1ccncc1 |
| InChI | InChI=1S/C17H14F3N3OS2/c1-11-15(25)23(13-2-4-14(5-3-13)26-17(18,19)20)16(24)22(11)10-12-6-8-21-9-7-12/h2-9,25H,10H2,1H3 |
| InChIKey | ZFTTYOKNPUECQV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|