C18H16F3N3O2S — CID 91092155
4-hydroxy-1-(1-pyridin-4-ylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one (PubChem CID 91092155) has the molecular formula C18H16F3N3O2S and a molecular weight of 395.41 g/mol. Its IUPAC name is 4-hydroxy-1-(1-pyridin-4-ylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one.
| Compound Name | 4-hydroxy-1-(1-pyridin-4-ylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 91092155 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-hydroxy-1-(1-pyridin-4-ylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-2-one |
| SMILES | CCC(c1ccncc1)n1cc(O)n(-c2ccc(SC(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C18H16F3N3O2S/c1-2-15(12-7-9-22-10-8-12)23-11-16(25)24(17(23)26)13-3-5-14(6-4-13)27-18(19,20)21/h3-11,15,25H,2H2,1H3 |
| InChIKey | LLVMITHWKFXXLK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |