C34H45N5O4 — CID 91060455
(2S)-2-[[(2-imidazol-1-ylacetyl)-[(2S)-2-methylbutyl]amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide (PubChem CID 91060455) has the molecular formula C34H45N5O4 and a molecular weight of 587.77 g/mol. Its IUPAC name is (2S)-2-[[(2-imidazol-1-ylacetyl)-[(2S)-2-methylbutyl]amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide.
| Compound Name | (2S)-2-[[(2-imidazol-1-ylacetyl)-[(2S)-2-methylbutyl]amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide |
|---|---|
| PubChem CID | 91060455 |
| Molecular Formula | C34H45N5O4 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | (2S)-2-[[(2-imidazol-1-ylacetyl)-[(2S)-2-methylbutyl]amino]-(4-methylpentanoyl)amino]-5-phenyl-N-phenylmethoxypent-4-enamide |
| SMILES | CC[C@H](C)CN(C(=O)Cn1ccnc1)N(C(=O)CCC(C)C)[C@@H](CC=Cc1ccccc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C34H45N5O4/c1-5-28(4)23-38(33(41)24-37-22-21-35-26-37)39(32(40)20-19-27(2)3)31(18-12-17-29-13-8-6-9-14-29)34(42)36-43-25-30-15-10-7-11-16-30/h6-17,21-22,26-28,31H,5,18-20,23-25H2,1-4H3,(H,36,42)/t28-,31-/m0/s1 |
| InChIKey | AMDLNAYCUPXXDS-IZEXYCQBSA-N |
| XLogP | 5.66 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|