C15H11F3N2O2 — CID 91060859
5-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,4-diazatricyclo[5.2.1.02,6]deca-5,8-dien-3-one (PubChem CID 91060859) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 5-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,4-diazatricyclo[5.2.1.02,6]deca-5,8-dien-3-one.
| Compound Name | 5-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,4-diazatricyclo[5.2.1.02,6]deca-5,8-dien-3-one |
|---|---|
| PubChem CID | 91060859 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,4-diazatricyclo[5.2.1.02,6]deca-5,8-dien-3-one |
| SMILES | O=c1n(-c2cccc(C(F)(F)F)c2)c(O)c2n1C1C=CC2C1 |
| InChI | InChI=1S/C15H11F3N2O2/c16-15(17,18)9-2-1-3-10(7-9)20-13(21)12-8-4-5-11(6-8)19(12)14(20)22/h1-5,7-8,11,21H,6H2 |
| InChIKey | RRAQEGCBTHPDQF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|