C15H15F3O3 — CID 91060970
2-[(2R,3S)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-enyl]oxiran-2-yl]acetaldehyde (PubChem CID 91060970) has the molecular formula C15H15F3O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[(2R,3S)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-enyl]oxiran-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-enyl]oxiran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 91060970 |
| Molecular Formula | C15H15F3O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[(2R,3S)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-enyl]oxiran-2-yl]acetaldehyde |
| SMILES | O=CC[C@H]1O[C@H]1CC=CCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3O3/c16-15(17,18)11-4-3-5-12(10-11)20-9-2-1-6-13-14(21-13)7-8-19/h1-5,8,10,13-14H,6-7,9H2/t13-,14+/m0/s1 |
| InChIKey | NIHMBVWHMNUQDN-UONOGXRCSA-N |
| XLogP | 3.39 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|