C24H23FN4O2S — CID 91062978
2-[2-[[4-(dimethylamino)phenyl]methyl]-7-fluoro-3-hydroxyisoindol-1-yl]sulfanyl-N-pyridin-2-ylacetamide (PubChem CID 91062978) has the molecular formula C24H23FN4O2S and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[2-[[4-(dimethylamino)phenyl]methyl]-7-fluoro-3-hydroxyisoindol-1-yl]sulfanyl-N-pyridin-2-ylacetamide.
| Compound Name | 2-[2-[[4-(dimethylamino)phenyl]methyl]-7-fluoro-3-hydroxyisoindol-1-yl]sulfanyl-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 91062978 |
| Molecular Formula | C24H23FN4O2S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[2-[[4-(dimethylamino)phenyl]methyl]-7-fluoro-3-hydroxyisoindol-1-yl]sulfanyl-N-pyridin-2-ylacetamide |
| SMILES | CN(C)c1ccc(Cn2c(O)c3cccc(F)c3c2SCC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C24H23FN4O2S/c1-28(2)17-11-9-16(10-12-17)14-29-23(31)18-6-5-7-19(25)22(18)24(29)32-15-21(30)27-20-8-3-4-13-26-20/h3-13,31H,14-15H2,1-2H3,(H,26,27,30) |
| InChIKey | BBVFJXZGWSWNEM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|