C22H19N3O3 — CID 91300907
2-(2-benzyl-3-hydroxyisoindol-1-yl)oxy-N-pyridin-2-ylacetamide (PubChem CID 91300907) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(2-benzyl-3-hydroxyisoindol-1-yl)oxy-N-pyridin-2-ylacetamide.
| Compound Name | 2-(2-benzyl-3-hydroxyisoindol-1-yl)oxy-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 91300907 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-(2-benzyl-3-hydroxyisoindol-1-yl)oxy-N-pyridin-2-ylacetamide |
| SMILES | O=C(COc1c2ccccc2c(O)n1Cc1ccccc1)Nc1ccccn1 |
| InChI | InChI=1S/C22H19N3O3/c26-20(24-19-12-6-7-13-23-19)15-28-22-18-11-5-4-10-17(18)21(27)25(22)14-16-8-2-1-3-9-16/h1-13,27H,14-15H2,(H,23,24,26) |
| InChIKey | BCTWKBGIVZCLAB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |