C28H32Cl3N3O3 — CID 91063172
N-[1-[2-(1-acetylpiperidin-4-yl)acetyl]-3-(3,4-dichlorophenyl)piperidin-4-yl]-4-(chloromethyl)benzamide (PubChem CID 91063172) has the molecular formula C28H32Cl3N3O3 and a molecular weight of 564.94 g/mol. Its IUPAC name is N-[1-[2-(1-acetylpiperidin-4-yl)acetyl]-3-(3,4-dichlorophenyl)piperidin-4-yl]-4-(chloromethyl)benzamide.
| Compound Name | N-[1-[2-(1-acetylpiperidin-4-yl)acetyl]-3-(3,4-dichlorophenyl)piperidin-4-yl]-4-(chloromethyl)benzamide |
|---|---|
| PubChem CID | 91063172 |
| Molecular Formula | C28H32Cl3N3O3 |
| Molecular Weight | 564.94 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | N-[1-[2-(1-acetylpiperidin-4-yl)acetyl]-3-(3,4-dichlorophenyl)piperidin-4-yl]-4-(chloromethyl)benzamide |
| SMILES | CC(=O)N1CCC(CC(=O)N2CCC(NC(=O)c3ccc(CCl)cc3)C(c3ccc(Cl)c(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C28H32Cl3N3O3/c1-18(35)33-11-8-19(9-12-33)14-27(36)34-13-10-26(23(17-34)22-6-7-24(30)25(31)15-22)32-28(37)21-4-2-20(16-29)3-5-21/h2-7,15,19,23,26H,8-14,16-17H2,1H3,(H,32,37) |
| InChIKey | KGVWWHDULHESDZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|